Compound Q&A

How is pentachlorobenzenethiol zinc salt (CAS: 117-97-5) typically synthesized?

Answer

Pentachlorobenzenethiol zinc salt
Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is typically synthesized through the reaction of zinc with pentachlorobenzenethiol. The process involves the addition of zinc to a solution of pentachlorobenzenethiol in an inert solvent. This reaction is conducted under controlled conditions to ensure high yield and selectivity. The product is then purified by recrystallization or other suitable methods.

About

CAS No 117-97-5
English Name Pentachlorobenzenethiol zinc salt
Molecular Formula C12Cl10S2Zn
Molecular Weight 628.2 g/mol
SMILES C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].[Zn+2]
InChIKey ONSIBMFFLJKTPT-UHFFFAOYSA-L
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is a crystalline solid with a high molecular weigh...

Compound Q&A

What industries use pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

When handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...