Compound Q&A

What precautions should be taken when handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

Answer

4-nitroquinolin-1-ium-1-olate
When handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed emergency procedures and proper handling guidelines.

About

CAS No 56-57-5
English Name 4-nitroquinolin-1-ium-1-olate
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-]
InChIKey YHQDZJICGQWFHK-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) typically synthesized?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is typically synthesized by the condensation of 4-nitro...

Compound Q&A

What industries use 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is used in various industries. It serves as a precursor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...