Compound Q&A

What industries use 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

Answer

4-nitroquinolin-1-ium-1-olate
4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is used in various industries. It serves as a precursor in the synthesis of pharmaceutical compounds, particularly in the development of drugs targeting biological pathways involving quinoline structures. Additionally, it finds applications in the production of sensors and semiconductors, where its unique chemical properties are utilized.

About

CAS No 56-57-5
English Name 4-nitroquinolin-1-ium-1-olate
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-]
InChIKey YHQDZJICGQWFHK-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) typically synthesized?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is typically synthesized by the condensation of 4-nitro...

Compound Q&A

What precautions should be taken when handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

When handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...