Compound Q&A

How is 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) typically synthesized?

Answer

4-nitroquinolin-1-ium-1-olate
4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is typically synthesized by the condensation of 4-nitroquinoline with sodium hydroxide to form the corresponding 1-olate salt. Common methods include the use of a 1:1 molar ratio of 4-nitroquinoline and sodium hydroxide in aqueous conditions. The reaction is carried out under basic conditions to ensure the formation of the 1-olate salt.

About

CAS No 56-57-5
English Name 4-nitroquinolin-1-ium-1-olate
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-]
InChIKey YHQDZJICGQWFHK-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is used in various industries. It serves as a precursor...

Compound Q&A

What precautions should be taken when handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

When handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5), it is essential to wear appropriate pers...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...