Compound Q&A

How is 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) typically synthesized?

Answer

4-nitroquinolin-1-ium-1-olate
4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is typically synthesized by the condensation of 4-nitroquinoline with sodium hydroxide to form the corresponding 1-olate salt. Common methods include the use of a 1:1 molar ratio of 4-nitroquinoline and sodium hydroxide in aqueous conditions. The reaction is carried out under basic conditions to ensure the formation of the 1-olate salt.

About

CAS No 56-57-5
English Name 4-nitroquinolin-1-ium-1-olate
Molecular Formula C9H6N2O3
Molecular Weight 190.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=[N+]2[O-])[N+](=O)[O-]
InChIKey YHQDZJICGQWFHK-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5) is used in various industries. It serves as a precursor...

Compound Q&A

What precautions should be taken when handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5)?

When handling 4-nitroquinolin-1-ium-1-olate (CAS: 56-57-5), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...