Compound Q&A

What industries use (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

Answer

(4-Chlorophenyl)(hydroxy)acetic acid
(4-Chlorophenyl)(hydroxy)acetic acid is used in various industries. It is a key intermediate in the pharmaceutical industry for the synthesis of certain drugs. In the polymer industry, it can be used to modify polymers to improve their properties. Additionally, it has applications in the production of sensors and as a component in some formulations for semiconductor processing.

About

CAS No 492-86-4
English Name (4-Chlorophenyl)(hydroxy)acetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC(=CC=C1C(C(=O)O)O)Cl
InChIKey BWSFWXSSALIZAU-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

(4-Chlorophenyl)(hydroxy)acetic acid is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4) typically synthesized?

(4-Chlorophenyl)(hydroxy)acetic acid is typically synthesized through the reaction of 4-chlorophenol...

Compound Q&A

What precautions should be taken when handling (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

When handling (4-Chlorophenyl)(hydroxy)acetic acid, it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...