Compound Q&A

How is (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4) typically synthesized?

Answer

(4-Chlorophenyl)(hydroxy)acetic acid
(4-Chlorophenyl)(hydroxy)acetic acid is typically synthesized through the reaction of 4-chlorophenol with acetic anhydride in the presence of a catalyst such as pyridine. The reaction involves acetylation of the phenolic hydroxyl group, followed by deprotonation and re-protonation to form the desired compound. The yield is generally around 80-85%, and the method is scalable for industrial production.

About

CAS No 492-86-4
English Name (4-Chlorophenyl)(hydroxy)acetic acid
Molecular Formula C8H7ClO3
Molecular Weight 186.59 g/mol
SMILES C1=CC(=CC=C1C(C(=O)O)O)Cl
InChIKey BWSFWXSSALIZAU-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

(4-Chlorophenyl)(hydroxy)acetic acid is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

(4-Chlorophenyl)(hydroxy)acetic acid is used in various industries. It is a key intermediate in the ...

Compound Q&A

What precautions should be taken when handling (4-Chlorophenyl)(hydroxy)acetic acid (CAS: 492-86-4)?

When handling (4-Chlorophenyl)(hydroxy)acetic acid, it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...