Compound Q&A

What industries use Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Answer

Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Diisopropyl 1,3-dithiolan-2-ylidenemalonate finds applications in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the modification of polymer properties, and in the semiconductor industry for the preparation of organic thin film transistors (OTFTs). It is also used in the development of chemical sensors due to its unique reactivity.

About

CAS No 50512-35-1
English Name Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Molecular Formula C12H18O4S2
Molecular Weight 290.41 g/mol
SMILES CC(C)OC(=O)C(=C1SCCS1)C(=O)OC(C)C
InChIKey UFHLMYOGRXOCSL-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1) typically synthesized?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate is synthesized by the condensation of 1,3-dithiolane-2-t...

Compound Q&A

What precautions should be taken when handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

When handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate, it is essential to use proper personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...