Compound Q&A

How is Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1) typically synthesized?

Answer

Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Diisopropyl 1,3-dithiolan-2-ylidenemalonate is synthesized by the condensation of 1,3-dithiolane-2-thione with malonoyl chloride in the presence of a Lewis acid catalyst, such as aluminum trichloride. The reaction typically yields a mixture of diastereomers with good selectivity and moderate to high yields.

About

CAS No 50512-35-1
English Name Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Molecular Formula C12H18O4S2
Molecular Weight 290.41 g/mol
SMILES CC(C)OC(=O)C(=C1SCCS1)C(=O)OC(C)C
InChIKey UFHLMYOGRXOCSL-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

When handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate, it is essential to use proper personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...