Compound Q&A

What are the physical and chemical properties of Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Answer

Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Diisopropyl 1,3-dithiolan-2-ylidenemalonate is a crystalline solid with a molecular weight of approximately 306.45 g/mol. It is slightly soluble in organic solvents like dichloromethane and acetone but insoluble in water. This compound is known for its reactivity towards nucleophiles and can undergo various chemical transformations under appropriate conditions.

About

CAS No 50512-35-1
English Name Diisopropyl 1,3-dithiolan-2-ylidenemalonate
Molecular Formula C12H18O4S2
Molecular Weight 290.41 g/mol
SMILES CC(C)OC(=O)C(=C1SCCS1)C(=O)OC(C)C
InChIKey UFHLMYOGRXOCSL-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1) typically synthesized?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate is synthesized by the condensation of 1,3-dithiolane-2-t...

Compound Q&A

What industries use Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

Diisopropyl 1,3-dithiolan-2-ylidenemalonate finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate (CAS: 50512-35-1)?

When handling Diisopropyl 1,3-dithiolan-2-ylidenemalonate, it is essential to use proper personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...