Compound Q&A

What precautions should be taken when handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Answer

Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
When handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately with care, and the material safety data sheet (MSDS) should be consulted for detailed safety instructions.

About

English Name Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
Molecular Formula C20H16Cl2Zr
Molecular Weight 418.47 g/mol
EINECS 456-950-5
SMILES Cl[Zr]1(Cl)C2C(CCC(C31)=CC4=C3C=CC=C4)=CC5=C2C=CC=C5
InChIKey IJSDUKZKUCXMRL-UHFFFAOYSA-L
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is a yellow crystalline solid with a molecular weigh...

Compound Q&A

How is Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8) typically synthesized?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is typically synthesized by reacting zirconium tetra...

Compound Q&A

What industries use Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is widely used in the pharmaceutical, polymer, and c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...