Compound Q&A

What are the physical and chemical properties of Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Answer

Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is a yellow crystalline solid with a molecular weight of approximately 416.28 g/mol. It has low solubility in common organic solvents and is reactive towards moisture and air. This compound is known for its high reactivity in organometallic chemistry, particularly in catalytic applications.

About

English Name Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
Molecular Formula C20H16Cl2Zr
Molecular Weight 418.47 g/mol
EINECS 456-950-5
SMILES Cl[Zr]1(Cl)C2C(CCC(C31)=CC4=C3C=CC=C4)=CC5=C2C=CC=C5
InChIKey IJSDUKZKUCXMRL-UHFFFAOYSA-L
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8) typically synthesized?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is typically synthesized by reacting zirconium tetra...

Compound Q&A

What industries use Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is widely used in the pharmaceutical, polymer, and c...

Compound Q&A

What precautions should be taken when handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

When handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...