Compound Q&A

What industries use Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Answer

Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is widely used in the pharmaceutical, polymer, and catalysis industries. It serves as a catalyst in various polymerization reactions and is also used in the development of advanced materials and sensors.

About

English Name Dichloro(rac-ethylenebis(indenyl))zirconium(IV)
Molecular Formula C20H16Cl2Zr
Molecular Weight 418.47 g/mol
EINECS 456-950-5
SMILES Cl[Zr]1(Cl)C2C(CCC(C31)=CC4=C3C=CC=C4)=CC5=C2C=CC=C5
InChIKey IJSDUKZKUCXMRL-UHFFFAOYSA-L
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is a yellow crystalline solid with a molecular weigh...

Compound Q&A

How is Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8) typically synthesized?

Dichloro(rac-ethylenebis(indenyl))zirconium(IV) is typically synthesized by reacting zirconium tetra...

Compound Q&A

What precautions should be taken when handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV) (CAS: 100080-82-8)?

When handling Dichloro(rac-ethylenebis(indenyl))zirconium(IV), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...