Compound Q&A

What precautions should be taken when handling Z-D-Glu-OBzl (CAS: 65706-99-2)?

Answer

Z-D-Glu-OBzl
When handling Z-D-Glu-OBzl (CAS: 65706-99-2), appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn. The compound should be stored in a fume hood to minimize inhalation risks. In case of a spill, it should be carefully cleaned up using absorbent materials. Always refer to the Material Safety Data Sheet (MSDS/SDS) for specific safety instructions and emergency procedures.

About

CAS No 65706-99-2
English Name Z-D-Glu-OBzl
Molecular Formula C20H21NO6
Molecular Weight 371.39 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CCC(=O)O)NC(=O)OCC2=CC=CC=C2
InChIKey VWHKODOUMSMUAF-QGZVFWFLSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Z-D-Glu-OBzl (CAS: 65706-99-2)?

Z-D-Glu-OBzl (CAS: 65706-99-2) is a crystalline compound with a molecular weight of approximately 34...

Compound Q&A

How is Z-D-Glu-OBzl (CAS: 65706-99-2) typically synthesized?

Z-D-Glu-OBzl (CAS: 65706-99-2) is synthesized by acylating D-Glu (L-glutamic acid) with pentafluorop...

Compound Q&A

What industries use Z-D-Glu-OBzl (CAS: 65706-99-2)?

Z-D-Glu-OBzl (CAS: 65706-99-2) is used in the pharmaceutical industry for the synthesis of certain p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...