Compound Q&A

What are the physical and chemical properties of Z-D-Glu-OBzl (CAS: 65706-99-2)?

Answer

Z-D-Glu-OBzl
Z-D-Glu-OBzl (CAS: 65706-99-2) is a crystalline compound with a molecular weight of approximately 345.44 g/mol. It has a slightly soluble nature in water and a high solubility in organic solvents like methanol and acetone. This compound is reactive towards nucleophiles and can undergo esterification and amidation reactions. It exhibits good stability under basic conditions but is sensitive to strong acids.

About

CAS No 65706-99-2
English Name Z-D-Glu-OBzl
Molecular Formula C20H21NO6
Molecular Weight 371.39 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CCC(=O)O)NC(=O)OCC2=CC=CC=C2
InChIKey VWHKODOUMSMUAF-QGZVFWFLSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Z-D-Glu-OBzl (CAS: 65706-99-2) typically synthesized?

Z-D-Glu-OBzl (CAS: 65706-99-2) is synthesized by acylating D-Glu (L-glutamic acid) with pentafluorop...

Compound Q&A

What industries use Z-D-Glu-OBzl (CAS: 65706-99-2)?

Z-D-Glu-OBzl (CAS: 65706-99-2) is used in the pharmaceutical industry for the synthesis of certain p...

Compound Q&A

What precautions should be taken when handling Z-D-Glu-OBzl (CAS: 65706-99-2)?

When handling Z-D-Glu-OBzl (CAS: 65706-99-2), appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...