Compound Q&A

What industries use Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Answer

Daclatasvir dihydrochloride
Daclatasvir dihydrochloride is primarily used in the pharmaceutical industry for the treatment of hepatitis C. It is also of interest in research for its antiviral properties, making it relevant to the bioscience and biotechnology sectors. Its synthetic nature also makes it relevant to chemical research and development.

About

English Name Daclatasvir dihydrochloride
Molecular Formula C40H52Cl2N8O6
Molecular Weight 811.812 g/mol
SMILES COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C.Cl.Cl
InChIKey BVZLLUDATICXCI-JMSCDMLISA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Daclatasvir dihydrochloride is a crystalline compound with a molecular weight of approximately 502.7...

Compound Q&A

How is Daclatasvir dihydrochloride (CAS: 1009119-65-6) typically synthesized?

Daclatasvir dihydrochloride is synthesized through a multi-step process involving condensation react...

Compound Q&A

What precautions should be taken when handling Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

When handling Daclatasvir dihydrochloride, it is essential to wear appropriate personal protective e...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...