Compound Q&A

How is Daclatasvir dihydrochloride (CAS: 1009119-65-6) typically synthesized?

Answer

Daclatasvir dihydrochloride
Daclatasvir dihydrochloride is synthesized through a multi-step process involving condensation reactions, amidation, and hydrochloridation steps. The key reaction involves the coupling of a protected amino acid derivative with an aromatic ring, followed by deprotection and hydrochloridation. The process yields a highly selective and pure product with good yield.

About

English Name Daclatasvir dihydrochloride
Molecular Formula C40H52Cl2N8O6
Molecular Weight 811.81 g/mol
SMILES COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C.Cl.Cl
InChIKey BVZLLUDATICXCI-JMSCDMLISA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Daclatasvir dihydrochloride is a crystalline compound with a molecular weight of approximately 502.7...

Compound Q&A

What industries use Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Daclatasvir dihydrochloride is primarily used in the pharmaceutical industry for the treatment of he...

Compound Q&A

What precautions should be taken when handling Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

When handling Daclatasvir dihydrochloride, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...