Compound Q&A

What are the physical and chemical properties of Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Answer

Daclatasvir dihydrochloride
Daclatasvir dihydrochloride is a crystalline compound with a molecular weight of approximately 502.7 g/mol. It has a high solubility in water and is relatively stable under normal conditions. The compound exhibits moderate reactivity with acidic and basic substances. Its dihydrochloride form enhances its water solubility, making it more bioavailable.

About

English Name Daclatasvir dihydrochloride
Molecular Formula C40H52Cl2N8O6
Molecular Weight 811.81 g/mol
SMILES COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc([nH]1)c1ccc(cc1)c1ccc(cc1)c1cnc([nH]1)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)OC)C(C)C.Cl.Cl
InChIKey BVZLLUDATICXCI-JMSCDMLISA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Daclatasvir dihydrochloride (CAS: 1009119-65-6) typically synthesized?

Daclatasvir dihydrochloride is synthesized through a multi-step process involving condensation react...

Compound Q&A

What industries use Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

Daclatasvir dihydrochloride is primarily used in the pharmaceutical industry for the treatment of he...

Compound Q&A

What precautions should be taken when handling Daclatasvir dihydrochloride (CAS: 1009119-65-6)?

When handling Daclatasvir dihydrochloride, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...