Compound Q&A

What are the physical and chemical properties of (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine (CAS: 395116-70-8)?

Answer

(s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine
The compound (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine is an organophosphine with a crystalline form. Its molecular weight is approximately 511.7 g/mol. This compound has limited water solubility, making it suitable for organic synthesis. It is known for its reactivity in coordination chemistry and as a ligand in transition metal complexes. It is typically used in high purity and handled under inert conditions to avoid degradation.

About

English Name (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine
Molecular Formula C27H37P
Molecular Weight 392.57 g/mol
SMILES C1C2CC3CC1CC(C2)(C3)P(CC4=CC=CC=C4)C56CC7CC(C5)CC(C7)C6
InChIKey ANIAFEJRWQDKDV-ANIFQACUSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine (CAS: 395116-70-8) typically synthesized?

The compound (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine is synthesized through a multi-step p...

Compound Q&A

What industries use (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine (CAS: 395116-70-8)?

The (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine is widely used in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine (CAS: 395116-70-8)?

When handling (s)-Di-(3s,5s,7s)-adamantan-1-yl(benzyl)phosphine, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...