Compound Q&A

What industries use 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

Answer

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (1:1)
1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) is primarily used in the pharmaceutical industry for its potential therapeutic applications, particularly in central nervous system research. It has also found applications in the polymer industry, where it serves as a stabilizer or additive. Additionally, this compound is used in the development of sensors and as a precursor in semiconductor manufacturing due to its unique physicochemical properties.

About

CAS No 52605-52-4
English Name 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (1:1)
Molecular Formula C13H19Cl3N2
Molecular Weight 309.67 g/mol
SMILES C1CN(CCN1CCCCl)C2=CC(=CC=C2)Cl.Cl
InChIKey JVLRNANYLVRULL-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) is a crystalline sol...

Compound Q&A

How is 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) typically synthesized?

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride is typically synthesized by the reacti...

Compound Q&A

What precautions should be taken when handling 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

When handling 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...