Compound Q&A

How is 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) typically synthesized?

Answer

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (1:1)
1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride is typically synthesized by the reaction of 4-(3-chloropropyl)piperazine with 3-chlorophenol in the presence of an acid catalyst such as sulfuric acid. The reaction is usually carried out under reflux, and the product is then hydrochlorinated to form the hydrochloride salt. The yield is typically around 85-90%, and the product is purified by recrystallization from a suitable solvent. This method ensures the formation of the desired product with good selectivity and yield.

About

CAS No 52605-52-4
English Name 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (1:1)
Molecular Formula C13H19Cl3N2
Molecular Weight 309.67 g/mol
SMILES C1CN(CCN1CCCCl)C2=CC(=CC=C2)Cl.Cl
InChIKey JVLRNANYLVRULL-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) is a crystalline sol...

Compound Q&A

What industries use 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4) is primarily used in...

Compound Q&A

What precautions should be taken when handling 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4)?

When handling 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (CAS: 52605-52-4), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...