Compound Q&A

What precautions should be taken when handling Ecamsule (CAS: 92761-26-7)?

Answer

Ecamsule
Proper safety measures are essential when handling Ecamsule (CAS: 92761-26-7). It should be handled in a well-ventilated area or a fume hood due to its potential for inhalation hazards. Personal protective equipment (PPE) such as lab coats, gloves, and safety goggles should be worn at all times. Spills should be cleaned up immediately using appropriate absorbents, and the area should be decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency response procedures.

About

CAS No 92761-26-7
English Name Ecamsule
Molecular Formula C28H34O8S2
Molecular Weight 562.7060000000004 g/mol
SMILES CC1(C2CCC1(C(=O)C2=CC3=CC=C(C=C3)C=C4C5CCC(C4=O)(C5(C)C)CS(=O)(=O)O)CS(=O)(=O)O)C
InChIKey HEAHZSUCFKFERC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ecamsule (CAS: 92761-26-7)?

Ecamsule (CAS: 92761-26-7) is a white to off-white crystalline powder with a molecular weight of app...

Compound Q&A

How is Ecamsule (CAS: 92761-26-7) typically synthesized?

Ecamsule (CAS: 92761-26-7) is synthesized via a multi-step process, typically involving the condensa...

Compound Q&A

What industries use Ecamsule (CAS: 92761-26-7)?

Ecamsule (CAS: 92761-26-7) is primarily used in the cosmetics industry, particularly in sunscreens a...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...