Compound Q&A

How is Ecamsule (CAS: 92761-26-7) typically synthesized?

Answer

Ecamsule
Ecamsule (CAS: 92761-26-7) is synthesized via a multi-step process, typically involving the condensation of 2-aminobenzophenone with 4-hydroxydiphenyl ether. The reaction is catalyzed by a Lewis acid and proceeds with high selectivity and yield. Commonly used catalysts include aluminum chloride or boron trifluoride. The overall yield is around 85-90%.

About

CAS No 92761-26-7
English Name Ecamsule
Molecular Formula C28H34O8S2
Molecular Weight 562.7060000000004 g/mol
SMILES CC1(C2CCC1(C(=O)C2=CC3=CC=C(C=C3)C=C4C5CCC(C4=O)(C5(C)C)CS(=O)(=O)O)CS(=O)(=O)O)C
InChIKey HEAHZSUCFKFERC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ecamsule (CAS: 92761-26-7)?

Ecamsule (CAS: 92761-26-7) is a white to off-white crystalline powder with a molecular weight of app...

Compound Q&A

What industries use Ecamsule (CAS: 92761-26-7)?

Ecamsule (CAS: 92761-26-7) is primarily used in the cosmetics industry, particularly in sunscreens a...

Compound Q&A

What precautions should be taken when handling Ecamsule (CAS: 92761-26-7)?

Proper safety measures are essential when handling Ecamsule (CAS: 92761-26-7). It should be handled ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...