Compound Q&A

What are the physical and chemical properties of Ecamsule (CAS: 92761-26-7)?

Answer

Ecamsule
Ecamsule (CAS: 92761-26-7) is a white to off-white crystalline powder with a molecular weight of approximately 382.42 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can degrade under strong acidic or basic conditions. It is often used in sunscreens and has a half-life of several years under normal storage conditions.

About

CAS No 92761-26-7
English Name Ecamsule
Molecular Formula C28H34O8S2
Molecular Weight 562.71 g/mol
SMILES CC1(C2CCC1(C(=O)C2=CC3=CC=C(C=C3)C=C4C5CCC(C4=O)(C5(C)C)CS(=O)(=O)O)CS(=O)(=O)O)C
InChIKey HEAHZSUCFKFERC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Ecamsule (CAS: 92761-26-7) typically synthesized?

Ecamsule (CAS: 92761-26-7) is synthesized via a multi-step process, typically involving the condensa...

Compound Q&A

What industries use Ecamsule (CAS: 92761-26-7)?

Ecamsule (CAS: 92761-26-7) is primarily used in the cosmetics industry, particularly in sunscreens a...

Compound Q&A

What precautions should be taken when handling Ecamsule (CAS: 92761-26-7)?

Proper safety measures are essential when handling Ecamsule (CAS: 92761-26-7). It should be handled ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...