Compound Q&A

What precautions should be taken when handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

Answer

2-Aminobenzothiazole-6-carboxylic acid
When handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation risks. If a spill occurs, clean it up in a fume hood using appropriate absorbents and dispose of waste according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

CAS No 93-85-6
English Name 2-Aminobenzothiazole-6-carboxylic acid
Molecular Formula C8H6N2O2S
Molecular Weight 194.21 g/mol
SMILES C1=CC2=C(C=C1C(=O)O)SC(=N2)N
InChIKey ZEAKWWWXCZMODH-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is a white or light yellow crystalline solid w...

Compound Q&A

How is 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) typically synthesized?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is typically synthesized via the condensation ...

Compound Q&A

What industries use 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is used in various industries, including pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...