Compound Q&A

What industries use 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

Answer

2-Aminobenzothiazole-6-carboxylic acid
2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is used in various industries, including pharmaceuticals for the synthesis of drug intermediates, polymers for special chemical properties, and sensors for detecting specific analytes. It also finds applications in the production of semiconductors and other advanced materials.

About

CAS No 93-85-6
English Name 2-Aminobenzothiazole-6-carboxylic acid
Molecular Formula C8H6N2O2S
Molecular Weight 194.21 g/mol
SMILES C1=CC2=C(C=C1C(=O)O)SC(=N2)N
InChIKey ZEAKWWWXCZMODH-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is a white or light yellow crystalline solid w...

Compound Q&A

How is 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) typically synthesized?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is typically synthesized via the condensation ...

Compound Q&A

What precautions should be taken when handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

When handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...