Compound Q&A

How is 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) typically synthesized?

Answer

2-Aminobenzothiazole-6-carboxylic acid
2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is typically synthesized via the condensation of 2-aminobenzothiazole with a carboxylic acid chloride in the presence of a base like triethylamine. The reaction yields the target compound in good to excellent purity with high selectivity.

About

CAS No 93-85-6
English Name 2-Aminobenzothiazole-6-carboxylic acid
Molecular Formula C8H6N2O2S
Molecular Weight 194.21 g/mol
SMILES C1=CC2=C(C=C1C(=O)O)SC(=N2)N
InChIKey ZEAKWWWXCZMODH-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is a white or light yellow crystalline solid w...

Compound Q&A

What industries use 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6)?

When handling 2-Aminobenzothiazole-6-carboxylic acid (CAS: 93-85-6), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...