Compound Q&A

What precautions should be taken when handling 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

Answer

1,3-Benzothiazole-6-sulfonyl chloride
When handling 1,3-Benzothiazole-6-sulfonyl chloride, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. It should be stored in a well-ventilated area, preferably in a fume hood. In case of a spill, it is recommended to use absorbent materials and dispose of them according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

English Name 1,3-Benzothiazole-6-sulfonyl chloride
Molecular Formula C7H4ClNO2S2
Molecular Weight 233.7 g/mol
SMILES C1=CC2=C(C=C1S(=O)(=O)Cl)SC=N2
InChIKey XQOLJTWXFUSVOR-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

1,3-Benzothiazole-6-sulfonyl chloride is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3) typically synthesized?

1,3-Benzothiazole-6-sulfonyl chloride is commonly synthesized through the chlorosulfonation of 1,3-b...

Compound Q&A

What industries use 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

1,3-Benzothiazole-6-sulfonyl chloride finds applications in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...