Compound Q&A

What are the physical and chemical properties of 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

Answer

1,3-Benzothiazole-6-sulfonyl chloride
1,3-Benzothiazole-6-sulfonyl chloride is a crystalline solid with a molecular weight of approximately 231.19 g/mol. It is soluble in organic solvents like dichloromethane and ethyl acetate. This compound displays moderate reactivity, particularly in nucleophilic substitution reactions. It has low water solubility, making it suitable for organic synthesis applications.

About

English Name 1,3-Benzothiazole-6-sulfonyl chloride
Molecular Formula C7H4ClNO2S2
Molecular Weight 233.7 g/mol
SMILES C1=CC2=C(C=C1S(=O)(=O)Cl)SC=N2
InChIKey XQOLJTWXFUSVOR-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3) typically synthesized?

1,3-Benzothiazole-6-sulfonyl chloride is commonly synthesized through the chlorosulfonation of 1,3-b...

Compound Q&A

What industries use 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

1,3-Benzothiazole-6-sulfonyl chloride finds applications in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

When handling 1,3-Benzothiazole-6-sulfonyl chloride, appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...