Compound Q&A

What industries use 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

Answer

1,3-Benzothiazole-6-sulfonyl chloride
1,3-Benzothiazole-6-sulfonyl chloride finds applications in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the polymer industry as a stabilizer and in the production of conductive polymers. Additionally, it has applications in the development of sensors and in the electronics industry for its ability to form stable complexes.

About

English Name 1,3-Benzothiazole-6-sulfonyl chloride
Molecular Formula C7H4ClNO2S2
Molecular Weight 233.7 g/mol
SMILES C1=CC2=C(C=C1S(=O)(=O)Cl)SC=N2
InChIKey XQOLJTWXFUSVOR-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

1,3-Benzothiazole-6-sulfonyl chloride is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3) typically synthesized?

1,3-Benzothiazole-6-sulfonyl chloride is commonly synthesized through the chlorosulfonation of 1,3-b...

Compound Q&A

What precautions should be taken when handling 1,3-Benzothiazole-6-sulfonyl chloride (CAS: 181124-40-3)?

When handling 1,3-Benzothiazole-6-sulfonyl chloride, appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...