Compound Q&A

What industries use (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

Answer

(2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
This compound (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) finds application in the pharmaceutical and polymer industries. It is used as a precursor in the synthesis of certain drugs and also as a monomer in the production of polymers with specific properties. Additionally, it can be utilized in the manufacturing of sensors and semiconductors for its structural and functional characteristics.

About

CAS No 64960-75-4
English Name (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)N
InChIKey MXWMFBYWXMXRPD-RXMQYKEDSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

The compound (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) is a cry...

Compound Q&A

How is (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) typically synthesized?

The synthesis of (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) is t...

Compound Q&A

What precautions should be taken when handling (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

When handling (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...