Compound Q&A

What are the physical and chemical properties of (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

Answer

(2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
The compound (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) is a crystalline solid with a molecular weight of approximately 190.32 g/mol. It has a pKₐ value around 2.2 and is soluble in water and ethanol. This compound is known for its reactivity, particularly towards nucleophilic substitution reactions and condensation reactions. It is used in various applications due to its unique structural features.

About

CAS No 64960-75-4
English Name (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)N
InChIKey MXWMFBYWXMXRPD-RXMQYKEDSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) typically synthesized?

The synthesis of (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) is t...

Compound Q&A

What industries use (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

This compound (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4) finds a...

Compound Q&A

What precautions should be taken when handling (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4)?

When handling (2R)-2-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 64960-75-4), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...