Compound Q&A

What precautions should be taken when handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

Answer

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
When handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3), it is essential to wear personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight. Handling should be conducted in a fume hood due to its potential to undergo photodegradation. In case of a spill, immediately clean up with appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further instructions.

About

CAS No 134-04-3
English Name 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
Molecular Formula C15H11ClO5
Molecular Weight 306.7 g/mol
SMILES C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O.[Cl-]
InChIKey YPVZJXMTXCOTJN-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is a crystalline compound wi...

Compound Q&A

How is 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) typically synthesized?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is typically synthesized via...

Compound Q&A

What industries use 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is used in various industrie...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...