Compound Q&A

What industries use 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

Answer

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is used in various industries, including pharmaceuticals for developing new drug candidates, sensors for environmental monitoring, and semiconductors for organic electronics. Its unique chemical structure makes it suitable for applications in polymer synthesis and as a photostable chromophore.

About

CAS No 134-04-3
English Name 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
Molecular Formula C15H11ClO5
Molecular Weight 306.7 g/mol
SMILES C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O.[Cl-]
InChIKey YPVZJXMTXCOTJN-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is a crystalline compound wi...

Compound Q&A

How is 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) typically synthesized?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is typically synthesized via...

Compound Q&A

What precautions should be taken when handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

When handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...