Compound Q&A

What are the physical and chemical properties of 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

Answer

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is a crystalline compound with a molecular weight of approximately 344.26 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound exhibits limited reactivity, showing stability under neutral conditions. It can undergo photodegradation under UV light, making appropriate storage conditions necessary.

About

CAS No 134-04-3
English Name 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride
Molecular Formula C15H11ClO5
Molecular Weight 306.7 g/mol
SMILES C1=CC(=CC=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O.[Cl-]
InChIKey YPVZJXMTXCOTJN-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) typically synthesized?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is typically synthesized via...

Compound Q&A

What industries use 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3) is used in various industrie...

Compound Q&A

What precautions should be taken when handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3)?

When handling 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)chromenium chloride (CAS: 134-04-3), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...