Compound Q&A

What industries use Aureobasidin A (CAS: 127785-64-2)?

Answer

Aureobasidin A
Aureobasidin A (CAS: 127785-64-2) finds applications in various industries. In pharmaceuticals, it has potential as an antifungal agent. It is also used in polymer synthesis as a molecular weight regulator, in sensor technology for detection of specific biomarkers, and in semiconductor manufacturing for quality control. Its bioactive properties make it valuable in both research and commercial applications.

About

English Name Aureobasidin A
Molecular Formula C60H92N8O11
Molecular Weight 1101.44 g/mol
SMILES CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C(C)C)C)C(C)CC)C(C)(C)O)C)CC(C)C)C(C)C)C
InChIKey RLMLFADXHJLPSQ-QKCBWMAHSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aureobasidin A (CAS: 127785-64-2)?

Aureobasidin A (CAS: 127785-64-2) is a cyclic depsipeptide with a molecular weight of approximately ...

Compound Q&A

How is Aureobasidin A (CAS: 127785-64-2) typically synthesized?

Aureobasidin A (CAS: 127785-64-2) is typically synthesized through a multi-step chemical process inv...

Compound Q&A

What precautions should be taken when handling Aureobasidin A (CAS: 127785-64-2)?

When handling Aureobasidin A (CAS: 127785-64-2), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...