Compound Q&A

How is Aureobasidin A (CAS: 127785-64-2) typically synthesized?

Answer

Aureobasidin A
Aureobasidin A (CAS: 127785-64-2) is typically synthesized through a multi-step chemical process involving peptide coupling, amidation, and cyclization reactions. The key synthetic route involves the condensation of suitable amino acids, followed by peptide bond formation and cyclization. The use of catalysts such as HOBt and DCC is common to enhance reactivity and selectivity. The overall yield is around 40-50%, and the method is known for its high chemical and enantioselectivity.

About

English Name Aureobasidin A
Molecular Formula C60H92N8O11
Molecular Weight 1101.44 g/mol
SMILES CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C(C)C)C)C(C)CC)C(C)(C)O)C)CC(C)C)C(C)C)C
InChIKey RLMLFADXHJLPSQ-QKCBWMAHSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aureobasidin A (CAS: 127785-64-2)?

Aureobasidin A (CAS: 127785-64-2) is a cyclic depsipeptide with a molecular weight of approximately ...

Compound Q&A

What industries use Aureobasidin A (CAS: 127785-64-2)?

Aureobasidin A (CAS: 127785-64-2) finds applications in various industries. In pharmaceuticals, it h...

Compound Q&A

What precautions should be taken when handling Aureobasidin A (CAS: 127785-64-2)?

When handling Aureobasidin A (CAS: 127785-64-2), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...