Compound Q&A

What are the physical and chemical properties of Aureobasidin A (CAS: 127785-64-2)?

Answer

Aureobasidin A
Aureobasidin A (CAS: 127785-64-2) is a cyclic depsipeptide with a molecular weight of approximately 506.4 g/mol. It is sparingly soluble in water but highly soluble in organic solvents like methanol and acetonitrile. Chemically, it exhibits moderate reactivity towards nucleophiles and is stable under acidic and neutral conditions but can be degraded under basic conditions. Its crystalline form has been characterized by X-ray crystallography, revealing a unique cyclic structure with specific hydrogen bonding patterns.

About

English Name Aureobasidin A
Molecular Formula C60H92N8O11
Molecular Weight 1101.44 g/mol
SMILES CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)OC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C(C)C)C)C(C)CC)C(C)(C)O)C)CC(C)C)C(C)C)C
InChIKey RLMLFADXHJLPSQ-QKCBWMAHSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Aureobasidin A (CAS: 127785-64-2) typically synthesized?

Aureobasidin A (CAS: 127785-64-2) is typically synthesized through a multi-step chemical process inv...

Compound Q&A

What industries use Aureobasidin A (CAS: 127785-64-2)?

Aureobasidin A (CAS: 127785-64-2) finds applications in various industries. In pharmaceuticals, it h...

Compound Q&A

What precautions should be taken when handling Aureobasidin A (CAS: 127785-64-2)?

When handling Aureobasidin A (CAS: 127785-64-2), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...