Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

Answer

9,9'-Spirobi[fluoren]-2-ylboronic acid
When handling 9,9'-Spirobi[fluoren]-2-ylboronic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. The substance should be stored in a dry environment, away from moisture. In case of spill, it should be cleaned up promptly using appropriate chemical spill kits. Always refer to the safety data sheet (SDS) for detailed safety instructions.

About

English Name 9,9'-Spirobi[fluoren]-2-ylboronic acid
Molecular Formula C25H17BO2
Molecular Weight 360.22 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O
InChIKey WDDLHUWVLROJLA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

9,9'-Spirobi[fluoren]-2-ylboronic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2) typically synthesized?

9,9'-Spirobi[fluoren]-2-ylboronic acid is synthesized via a multistep process involving the formatio...

Compound Q&A

What industries use 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

9,9'-Spirobi[fluoren]-2-ylboronic acid is used in various industries, primarily in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...