Compound Q&A

How is 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2) typically synthesized?

Answer

9,9'-Spirobi[fluoren]-2-ylboronic acid
9,9'-Spirobi[fluoren]-2-ylboronic acid is synthesized via a multistep process involving the formation of a spiro fluorene via alkyne metathesis and subsequent boronation using pinacol borane. The reaction typically requires mild conditions and can achieve high yields with good selectivity.

About

English Name 9,9'-Spirobi[fluoren]-2-ylboronic acid
Molecular Formula C25H17BO2
Molecular Weight 360.22 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O
InChIKey WDDLHUWVLROJLA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

9,9'-Spirobi[fluoren]-2-ylboronic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

9,9'-Spirobi[fluoren]-2-ylboronic acid is used in various industries, primarily in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

When handling 9,9'-Spirobi[fluoren]-2-ylboronic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...