Compound Q&A

What are the physical and chemical properties of 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

Answer

9,9'-Spirobi[fluoren]-2-ylboronic acid
9,9'-Spirobi[fluoren]-2-ylboronic acid is a crystalline solid with a molecular weight of approximately 384.23 g/mol. It is slightly soluble in organic solvents such as DMF and DMSO. Chemically, it is reactive and can undergo boronate ester formation reactions. It is stable under normal conditions but should be stored in a dry place to avoid moisture.

About

English Name 9,9'-Spirobi[fluoren]-2-ylboronic acid
Molecular Formula C25H17BO2
Molecular Weight 360.22 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O
InChIKey WDDLHUWVLROJLA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2) typically synthesized?

9,9'-Spirobi[fluoren]-2-ylboronic acid is synthesized via a multistep process involving the formatio...

Compound Q&A

What industries use 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

9,9'-Spirobi[fluoren]-2-ylboronic acid is used in various industries, primarily in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 9,9'-Spirobi[fluoren]-2-ylboronic acid (CAS: 236389-21-2)?

When handling 9,9'-Spirobi[fluoren]-2-ylboronic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...