Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

Answer

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
When handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2), it is crucial to wear appropriate personal protective equipment (PPE), including safety goggles, gloves, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (MSDS/SDS) should be consulted for proper disposal and emergency response procedures.

About

CAS No 367-86-2
English Name 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F
InChIKey HLDFCCHSOZWKAA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2) typically synthesized?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the nitration of 1-fluoro-4...

Compound Q&A

What industries use 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is used in various industries, particularly in pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...