Compound Q&A

What industries use 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

Answer

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is used in various industries, particularly in pharmaceuticals for the synthesis of drug intermediates, and in the production of sensors and semiconductors. It is also utilized in the polymer industry for the development of specialized polymers with enhanced properties.

About

CAS No 367-86-2
English Name 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F
InChIKey HLDFCCHSOZWKAA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2) typically synthesized?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the nitration of 1-fluoro-4...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

When handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...