Compound Q&A

How is 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2) typically synthesized?

Answer

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the nitration of 1-fluoro-4-(trifluoromethyl)benzene followed by nitration. This process involves the use of nitric acid and sulfuric acid as reagents, and the reaction is carried out under controlled conditions to ensure high selectivity and yield.

About

CAS No 367-86-2
English Name 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F
InChIKey HLDFCCHSOZWKAA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a crystalline solid with a molecular w...

Compound Q&A

What industries use 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

1-Fluoro-2-nitro-4-(trifluoromethyl)benzene is used in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS: 367-86-2)?

When handling 1-Fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...