Compound Q&A

What precautions should be taken when handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

Answer

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
When handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride, use appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation exposure. Spills should be handled with caution using appropriate absorbent materials. Refer to the safety data sheet (SDS) for detailed information on proper handling and emergency procedures.

About

CAS No 98892-75-2
English Name 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
Molecular Formula C9H17ClN2
Molecular Weight 188.7 g/mol
SMILES CCCCN1C=C[N+](=C1C)C.[Cl-]
InChIKey HHHYPTORQNESCU-UHFFFAOYSA-M
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight...

Compound Q&A

How is 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2) typically synthesized?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride can be synthesized by reacting 3-butyl-1,2-dimethyl-...

Compound Q&A

What industries use 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is utilized in the pharmaceutical industry for its c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...