Compound Q&A

What are the physical and chemical properties of 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

Answer

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight of approximately 221.32 g/mol. It is sparingly soluble in water and ethanol. This compound exhibits good thermal stability and moderate basicity. It is reactive towards acidic compounds and can be used in various synthetic reactions.

About

CAS No 98892-75-2
English Name 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
Molecular Formula C9H17ClN2
Molecular Weight 188.7 g/mol
SMILES CCCCN1C=C[N+](=C1C)C.[Cl-]
InChIKey HHHYPTORQNESCU-UHFFFAOYSA-M
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2) typically synthesized?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride can be synthesized by reacting 3-butyl-1,2-dimethyl-...

Compound Q&A

What industries use 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is utilized in the pharmaceutical industry for its c...

Compound Q&A

What precautions should be taken when handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

When handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride, use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...