Compound Q&A

How is 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2) typically synthesized?

Answer

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride can be synthesized by reacting 3-butyl-1,2-dimethyl-1H-imidazol-3-amine with hydrochloric acid. Commonly used conditions include refluxing the mixture in an inert solvent like methanol or ethanol at elevated temperatures. The yield is typically around 75-80%, and the product can be isolated by filtration and recrystallization.

About

CAS No 98892-75-2
English Name 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride
Molecular Formula C9H17ClN2
Molecular Weight 188.7 g/mol
SMILES CCCCN1C=C[N+](=C1C)C.[Cl-]
InChIKey HHHYPTORQNESCU-UHFFFAOYSA-M
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride is utilized in the pharmaceutical industry for its c...

Compound Q&A

What precautions should be taken when handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride (CAS: 98892-75-2)?

When handling 3-Butyl-1,2-dimethyl-1H-imidazol-3-ium chloride, use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...