Compound Q&A

What precautions should be taken when handling 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

Answer

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate
When handling 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate, it is crucial to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. Fume hoods should be used during handling to minimize inhalation risks. In case of a spill, it should be cleaned up carefully, and appropriate safety data sheets (SDS) should be consulted for detailed cleanup procedures and emergency response guidelines.

About

English Name 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)C(=O)OC
InChIKey LIWFYAVKYUQMRE-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is a white crystalline solid with a mo...

Compound Q&A

How is 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7) typically synthesized?

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is typically synthesized through the c...

Compound Q&A

What industries use 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is used in a variety of industries due...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...