Compound Q&A

What are the physical and chemical properties of 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

Answer

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate
3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is a white crystalline solid with a molecular weight of approximately 260.38 g/mol. It has a low solubility in water but is more soluble in common organic solvents like ethanol and acetone. The compound is known for its moderate reactivity and is susceptible to hydrolysis under basic conditions. It can form soluble salts and esters, and its reactivity makes it useful in organic synthesis and various chemical applications.

About

English Name 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)C(=O)OC
InChIKey LIWFYAVKYUQMRE-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7) typically synthesized?

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is typically synthesized through the c...

Compound Q&A

What industries use 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate is used in a variety of industries due...

Compound Q&A

What precautions should be taken when handling 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate (CAS: 122684-33-7)?

When handling 3-Methyl 1-(2-methyl-2-propanyl) 1,3-pyrrolidinedicarboxylate, it is crucial to use pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...