Compound Q&A

What precautions should be taken when handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Answer

Tetraphenyl Dipropyleneglycol Diphosphite
When handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be cleaned up immediately with appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 80584-85-6
English Name Tetraphenyl Dipropyleneglycol Diphosphite
Molecular Formula C30H32O7P2
Molecular Weight 566.5 g/mol
SMILES CC(COCC(C)OP(OC1=CC=CC=C1)OC2=CC=CC=C2)OP(OC3=CC=CC=C3)OC4=CC=CC=C4
InChIKey XZZWOTQMUOIIFX-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) is a crystalline compound with a molecul...

Compound Q&A

How is Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) typically synthesized?

Tetraphenyl Dipropyleneglycol Diphosphite is typically synthesized through the esterification of dip...

Compound Q&A

What industries use Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Tetraphenyl Dipropyleneglycol Diphosphite is widely used in the pharmaceutical, polymer, and semicon...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...