Compound Q&A

What industries use Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Answer

Tetraphenyl Dipropyleneglycol Diphosphite
Tetraphenyl Dipropyleneglycol Diphosphite is widely used in the pharmaceutical, polymer, and semiconductor industries. It serves as a stabilizer in polyolefin polymers, a phosphite ester in pharmaceutical formulations, and a reagent in sensor applications requiring phosphorus-containing compounds.

About

CAS No 80584-85-6
English Name Tetraphenyl Dipropyleneglycol Diphosphite
Molecular Formula C30H32O7P2
Molecular Weight 566.5 g/mol
SMILES CC(COCC(C)OP(OC1=CC=CC=C1)OC2=CC=CC=C2)OP(OC3=CC=CC=C3)OC4=CC=CC=C4
InChIKey XZZWOTQMUOIIFX-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) is a crystalline compound with a molecul...

Compound Q&A

How is Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) typically synthesized?

Tetraphenyl Dipropyleneglycol Diphosphite is typically synthesized through the esterification of dip...

Compound Q&A

What precautions should be taken when handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

When handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...